C14H20O9 — CID 86631770
(4S,5S,6S)-4,5-diacetyl-4,5,6-trihydroxy-6-[(1R)-1-hydroxyethyl]octane-2,3,7-trione (PubChem CID 86631770) has the molecular formula C14H20O9 and a molecular weight of 332.31 g/mol. Its IUPAC name is (4S,5S,6S)-4,5-diacetyl-4,5,6-trihydroxy-6-[(1R)-1-hydroxyethyl]octane-2,3,7-trione.
| Compound Name | (4S,5S,6S)-4,5-diacetyl-4,5,6-trihydroxy-6-[(1R)-1-hydroxyethyl]octane-2,3,7-trione |
|---|---|
| PubChem CID | 86631770 |
| Molecular Formula | C14H20O9 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | (4S,5S,6S)-4,5-diacetyl-4,5,6-trihydroxy-6-[(1R)-1-hydroxyethyl]octane-2,3,7-trione |
| SMILES | CC(=O)C(=O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)[C@](O)(C(C)=O)[C@@H](C)O |
| InChI | InChI=1S/C14H20O9/c1-6(15)11(20)13(22,9(4)18)14(23,10(5)19)12(21,7(2)16)8(3)17/h7,16,21-23H,1-5H3/t7-,12-,13+,14+/m1/s1 |
| InChIKey | BFQJOMCGTUZZFB-PRCPCBAVSA-N |
| XLogP | -2.51 |
| TPSA | 166.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | -2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|