C14H18O14 — CID 141191281
bis(2,3-dihydroxypropanoyl) 2,3-diacetyl-2,3-dihydroxybutanedioate (PubChem CID 141191281) has the molecular formula C14H18O14 and a molecular weight of 410.28 g/mol. Its IUPAC name is bis(2,3-dihydroxypropanoyl) 2,3-diacetyl-2,3-dihydroxybutanedioate.
| Compound Name | bis(2,3-dihydroxypropanoyl) 2,3-diacetyl-2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 141191281 |
| Molecular Formula | C14H18O14 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | bis(2,3-dihydroxypropanoyl) 2,3-diacetyl-2,3-dihydroxybutanedioate |
| SMILES | CC(=O)C(O)(C(=O)OC(=O)C(O)CO)C(O)(C(C)=O)C(=O)OC(=O)C(O)CO |
| InChI | InChI=1S/C14H18O14/c1-5(17)13(25,11(23)27-9(21)7(19)3-15)14(26,6(2)18)12(24)28-10(22)8(20)4-16/h7-8,15-16,19-20,25-26H,3-4H2,1-2H3 |
| InChIKey | GVYVDRINZLAGEB-UHFFFAOYSA-N |
| XLogP | -5.53 |
| TPSA | 242.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | -5.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|