C18H25BrO11 — CID 54315218
(6S,7S,8R)-6,7,8-triacetyl-1-bromo-6,7,8,10,11-pentahydroxydodecane-4,5,9-trione (PubChem CID 54315218) has the molecular formula C18H25BrO11 and a molecular weight of 497.29 g/mol. Its IUPAC name is (6S,7S,8R)-6,7,8-triacetyl-1-bromo-6,7,8,10,11-pentahydroxydodecane-4,5,9-trione.
| Compound Name | (6S,7S,8R)-6,7,8-triacetyl-1-bromo-6,7,8,10,11-pentahydroxydodecane-4,5,9-trione |
|---|---|
| PubChem CID | 54315218 |
| Molecular Formula | C18H25BrO11 |
| Molecular Weight | 497.29 g/mol |
| Exact Mass | 496.06 |
| IUPAC Name | (6S,7S,8R)-6,7,8-triacetyl-1-bromo-6,7,8,10,11-pentahydroxydodecane-4,5,9-trione |
| SMILES | CC(=O)[C@@](O)(C(=O)C(O)C(C)O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)C(=O)C(=O)CCCBr |
| InChI | InChI=1S/C18H25BrO11/c1-8(20)13(25)15(27)17(29,10(3)22)18(30,11(4)23)16(28,9(2)21)14(26)12(24)6-5-7-19/h8,13,20,25,28-30H,5-7H2,1-4H3/t8?,13?,16-,17+,18+/m0/s1 |
| InChIKey | SNRMESVYYHEEEL-UUJHPOAZSA-N |
| XLogP | -2.43 |
| TPSA | 203.57 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.29 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|