C14H19BrO10 — CID 57119703
(2R,3R,4S)-2,3,4-triacetyl-8-bromo-2,3,4,6,7-pentahydroxy-5-oxooctanal (PubChem CID 57119703) has the molecular formula C14H19BrO10 and a molecular weight of 427.20 g/mol. Its IUPAC name is (2R,3R,4S)-2,3,4-triacetyl-8-bromo-2,3,4,6,7-pentahydroxy-5-oxooctanal.
| Compound Name | (2R,3R,4S)-2,3,4-triacetyl-8-bromo-2,3,4,6,7-pentahydroxy-5-oxooctanal |
|---|---|
| PubChem CID | 57119703 |
| Molecular Formula | C14H19BrO10 |
| Molecular Weight | 427.20 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | (2R,3R,4S)-2,3,4-triacetyl-8-bromo-2,3,4,6,7-pentahydroxy-5-oxooctanal |
| SMILES | CC(=O)[C@](O)(C(=O)C(O)C(O)CBr)[C@@](O)(C(C)=O)[C@@](O)(C=O)C(C)=O |
| InChI | InChI=1S/C14H19BrO10/c1-6(17)12(23,5-16)14(25,8(3)19)13(24,7(2)18)11(22)10(21)9(20)4-15/h5,9-10,20-21,23-25H,4H2,1-3H3/t9?,10?,12-,13+,14-/m1/s1 |
| InChIKey | GIGAGXZRXDIBKQ-GLZKMDAQSA-N |
| XLogP | -3.17 |
| TPSA | 186.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.20 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|