C7H12O4 — CID 156702092
5,6-dihydroxyheptane-2,4-dione (PubChem CID 156702092) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 5,6-dihydroxyheptane-2,4-dione.
| Compound Name | 5,6-dihydroxyheptane-2,4-dione |
|---|---|
| PubChem CID | 156702092 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 5,6-dihydroxyheptane-2,4-dione |
| SMILES | CC(=O)CC(=O)C(O)C(C)O |
| InChI | InChI=1S/C7H12O4/c1-4(8)3-6(10)7(11)5(2)9/h5,7,9,11H,3H2,1-2H3 |
| InChIKey | ULFDUJOPDKWORY-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|