C14H24O4 — CID 159905404
2,6-dimethylheptane-3,5-dione;pentane-2,4-dione (PubChem CID 159905404) has the molecular formula C14H24O4 and a molecular weight of 256.34 g/mol. Its IUPAC name is 2,6-dimethylheptane-3,5-dione;pentane-2,4-dione.
| Compound Name | 2,6-dimethylheptane-3,5-dione;pentane-2,4-dione |
|---|---|
| PubChem CID | 159905404 |
| Molecular Formula | C14H24O4 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | 2,6-dimethylheptane-3,5-dione;pentane-2,4-dione |
| SMILES | CC(=O)CC(C)=O.CC(C)C(=O)CC(=O)C(C)C |
| InChI | InChI=1S/C9H16O2.C5H8O2/c1-6(2)8(10)5-9(11)7(3)4;1-4(6)3-5(2)7/h6-7H,5H2,1-4H3;3H2,1-2H3 |
| InChIKey | NWMXBDCXTSKSFP-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|