C7H12CuO2+2 — CID 54598918
copper 5-methylhexane-2,4-dione (PubChem CID 54598918) has the molecular formula C7H12CuO2+2 and a molecular weight of 191.72 g/mol. Its IUPAC name is copper 5-methylhexane-2,4-dione.
| Compound Name | copper 5-methylhexane-2,4-dione |
|---|---|
| PubChem CID | 54598918 |
| Molecular Formula | C7H12CuO2+2 |
| Molecular Weight | 191.72 g/mol |
| Exact Mass | 191.01 |
| IUPAC Name | copper 5-methylhexane-2,4-dione |
| SMILES | CC(=O)CC(=O)C(C)C.[Cu+2] |
| InChI | InChI=1S/C7H12O2.Cu/c1-5(2)7(9)4-6(3)8;/h5H,4H2,1-3H3;/q;+2 |
| InChIKey | IBOTVZJGEPSHLI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.72 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|