C12H24BrNO — CID 134202190
4-bromo-N,N-ditert-butylbutanamide (PubChem CID 134202190) has the molecular formula C12H24BrNO and a molecular weight of 278.23 g/mol. Its IUPAC name is 4-bromo-N,N-ditert-butylbutanamide.
| Compound Name | 4-bromo-N,N-ditert-butylbutanamide |
|---|---|
| PubChem CID | 134202190 |
| Molecular Formula | C12H24BrNO |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 4-bromo-N,N-ditert-butylbutanamide |
| SMILES | CC(C)(C)N(C(=O)CCCBr)C(C)(C)C |
| InChI | InChI=1S/C12H24BrNO/c1-11(2,3)14(12(4,5)6)10(15)8-7-9-13/h7-9H2,1-6H3 |
| InChIKey | IRIJUWALQGTDTA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|