C23H47BrN2O — CID 172581224
N-(4-aminobutyl)-N-(8-bromooctyl)-5,5,6,6-tetramethylheptanamide (PubChem CID 172581224) has the molecular formula C23H47BrN2O and a molecular weight of 447.55 g/mol. Its IUPAC name is N-(4-aminobutyl)-N-(8-bromooctyl)-5,5,6,6-tetramethylheptanamide.
| Compound Name | N-(4-aminobutyl)-N-(8-bromooctyl)-5,5,6,6-tetramethylheptanamide |
|---|---|
| PubChem CID | 172581224 |
| Molecular Formula | C23H47BrN2O |
| Molecular Weight | 447.55 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | N-(4-aminobutyl)-N-(8-bromooctyl)-5,5,6,6-tetramethylheptanamide |
| SMILES | CC(C)(C)C(C)(C)CCCC(=O)N(CCCCN)CCCCCCCCBr |
| InChI | InChI=1S/C23H47BrN2O/c1-22(2,3)23(4,5)16-14-15-21(27)26(20-13-11-18-25)19-12-9-7-6-8-10-17-24/h6-20,25H2,1-5H3 |
| InChIKey | YKNCLDOEGLODAV-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.55 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|