About 1,7-dibromo-4,4-dimethylheptane-3,5-dione
1,7-dibromo-4,4-dimethylheptane-3,5-dione (PubChem CID 19839144) has the molecular formula C9H14Br2O2
and a molecular weight of 314.02 g/mol. Its IUPAC name is 1,7-dibromo-4,4-dimethylheptane-3,5-dione.
Molecular Properties
| Compound Name | 1,7-dibromo-4,4-dimethylheptane-3,5-dione |
| PubChem CID | 19839144 |
| Molecular Formula | C9H14Br2O2 |
| Molecular Weight | 314.02 g/mol |
| Exact Mass | 311.94 |
| IUPAC Name | 1,7-dibromo-4,4-dimethylheptane-3,5-dione |
| SMILES | CC(C)(C(=O)CCBr)C(=O)CCBr |
| InChI | InChI=1S/C9H14Br2O2/c1-9(2,7(12)3-5-10)8(13)4-6-11/h3-6H2,1-2H3 |
| InChIKey | JFWXUZAWOLWHPF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.02 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1,7-dibromo-4,4-dimethylheptane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dibromo-4,4-dimethylheptane-3,5-dione?
The IUPAC name of 1,7-dibromo-4,4-dimethylheptane-3,5-dione (CID 19839144) is 1,7-dibromo-4,4-dimethylheptane-3,5-dione.
What is the SMILES notation for 1,7-dibromo-4,4-dimethylheptane-3,5-dione?
The canonical SMILES for 1,7-dibromo-4,4-dimethylheptane-3,5-dione is CC(C)(C(=O)CCBr)C(=O)CCBr.
What is the InChIKey of 1,7-dibromo-4,4-dimethylheptane-3,5-dione?
The InChIKey is JFWXUZAWOLWHPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14Br2O2/c1-9(2,7(12)3-5-10)8(13)4-6-11/h3-6H2,1-2H3.
What are the key properties of 1,7-dibromo-4,4-dimethylheptane-3,5-dione?
1,7-dibromo-4,4-dimethylheptane-3,5-dione has a molecular weight of 314.02 g/mol, XLogP of 2.72, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dibromo-4,4-dimethylheptane-3,5-dione is sourced from PubChem (CID 19839144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).