C14H17NO10S — CID 154088147
methyl (2S,3R,4S,5S)-3,4-diacetyl-5-carbonisothiocyanatidoyl-2,3,4,5-tetrahydroxy-6-oxoheptanoate (PubChem CID 154088147) has the molecular formula C14H17NO10S and a molecular weight of 391.35 g/mol. Its IUPAC name is methyl (2S,3R,4S,5S)-3,4-diacetyl-5-carbonisothiocyanatidoyl-2,3,4,5-tetrahydroxy-6-oxoheptanoate.
| Compound Name | methyl (2S,3R,4S,5S)-3,4-diacetyl-5-carbonisothiocyanatidoyl-2,3,4,5-tetrahydroxy-6-oxoheptanoate |
|---|---|
| PubChem CID | 154088147 |
| Molecular Formula | C14H17NO10S |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | methyl (2S,3R,4S,5S)-3,4-diacetyl-5-carbonisothiocyanatidoyl-2,3,4,5-tetrahydroxy-6-oxoheptanoate |
| SMILES | COC(=O)[C@@H](O)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@](O)(C(C)=O)C(=O)N=C=S |
| InChI | InChI=1S/C14H17NO10S/c1-6(16)12(22,9(19)10(20)25-4)14(24,8(3)18)13(23,7(2)17)11(21)15-5-26/h9,19,22-24H,1-4H3/t9-,12-,13+,14+/m1/s1 |
| InChIKey | UYXDARKZXCPYEX-QQUHWDOBSA-N |
| XLogP | -2.89 |
| TPSA | 187.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|