3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid

C11H22O3 — CID 162191705

IUPAC3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid
SMILESCC(=O)C(C)(C)C.CC(C)(C)C(=O)O
InChIInChI=1S/C6H12O.C5H10O2/c1-5(7)6(2,3)4;1-5(2,3)4(6)7/h1-4H3;1-3H3,(H,6,7)
InChIKeyZQJWIZUQYYEIPA-UHFFFAOYSA-N
MW202.29 g/mol
LogP2.74
Rot. Bonds

About 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid

3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid (PubChem CID 162191705) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid.

Molecular Properties

Compound Name3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid
PubChem CID162191705
Molecular FormulaC11H22O3
Molecular Weight202.29 g/mol
Exact Mass202.16
IUPAC Name3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid
SMILESCC(=O)C(C)(C)C.CC(C)(C)C(=O)O
InChIInChI=1S/C6H12O.C5H10O2/c1-5(7)6(2,3)4;1-5(2,3)4(6)7/h1-4H3;1-3H3,(H,6,7)
InChIKeyZQJWIZUQYYEIPA-UHFFFAOYSA-N
XLogP2.74
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.29
LogP ≤ 52.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid?
The IUPAC name of 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid (CID 162191705) is 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid.
What is the SMILES notation for 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid?
The canonical SMILES for 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid is CC(=O)C(C)(C)C.CC(C)(C)C(=O)O.
What is the InChIKey of 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid?
The InChIKey is ZQJWIZUQYYEIPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O.C5H10O2/c1-5(7)6(2,3)4;1-5(2,3)4(6)7/h1-4H3;1-3H3,(H,6,7).
What are the key properties of 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid?
3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid has a molecular weight of 202.29 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethylbutan-2-one;2,2-dimethylpropanoic acid is sourced from PubChem (CID 162191705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).