C5H10ClO2Re- — CID 25015528
2,2-dimethylpropanoic acid;rhenium;chloride (PubChem CID 25015528) has the molecular formula C5H10ClO2Re- and a molecular weight of 323.79 g/mol. Its IUPAC name is 2,2-dimethylpropanoic acid;rhenium;chloride.
| Compound Name | 2,2-dimethylpropanoic acid;rhenium;chloride |
|---|---|
| PubChem CID | 25015528 |
| Molecular Formula | C5H10ClO2Re- |
| Molecular Weight | 323.79 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 2,2-dimethylpropanoic acid;rhenium;chloride |
| SMILES | CC(C)(C)C(=O)O.[Cl-].[Re] |
| InChI | InChI=1S/C5H10O2.ClH.Re/c1-5(2,3)4(6)7;;/h1-3H3,(H,6,7);1H;/p-1 |
| InChIKey | UGNQUBCBECLRRM-UHFFFAOYSA-M |
| XLogP | -1.88 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.79 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |