2-cyclopropyl-2,3-dimethoxypropanoic acid

C8H14O4 — CID 116769537

IUPAC2-cyclopropyl-2,3-dimethoxypropanoic acid
SMILESCOCC(OC)(C(=O)O)C1CC1
InChIInChI=1S/C8H14O4/c1-11-5-8(12-2,7(9)10)6-3-4-6/h6H,3-5H2,1-2H3,(H,9,10)
InChIKeySMZLYUCPGOPNER-UHFFFAOYSA-N
MW174.20 g/mol
LogP0.51
Rot. Bonds5

About 2-cyclopropyl-2,3-dimethoxypropanoic acid

2-cyclopropyl-2,3-dimethoxypropanoic acid (PubChem CID 116769537) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-cyclopropyl-2,3-dimethoxypropanoic acid.

Molecular Properties

Compound Name2-cyclopropyl-2,3-dimethoxypropanoic acid
PubChem CID116769537
Molecular FormulaC8H14O4
Molecular Weight174.20 g/mol
Exact Mass174.09
IUPAC Name2-cyclopropyl-2,3-dimethoxypropanoic acid
SMILESCOCC(OC)(C(=O)O)C1CC1
InChIInChI=1S/C8H14O4/c1-11-5-8(12-2,7(9)10)6-3-4-6/h6H,3-5H2,1-2H3,(H,9,10)
InChIKeySMZLYUCPGOPNER-UHFFFAOYSA-N
XLogP0.51
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500174.20
LogP ≤ 50.51
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-cyclopropyl-2,3-dimethoxypropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-cyclopropyl-2,3-dimethoxypropanoic acid?
The IUPAC name of 2-cyclopropyl-2,3-dimethoxypropanoic acid (CID 116769537) is 2-cyclopropyl-2,3-dimethoxypropanoic acid.
What is the SMILES notation for 2-cyclopropyl-2,3-dimethoxypropanoic acid?
The canonical SMILES for 2-cyclopropyl-2,3-dimethoxypropanoic acid is COCC(OC)(C(=O)O)C1CC1.
What is the InChIKey of 2-cyclopropyl-2,3-dimethoxypropanoic acid?
The InChIKey is SMZLYUCPGOPNER-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O4/c1-11-5-8(12-2,7(9)10)6-3-4-6/h6H,3-5H2,1-2H3,(H,9,10).
What are the key properties of 2-cyclopropyl-2,3-dimethoxypropanoic acid?
2-cyclopropyl-2,3-dimethoxypropanoic acid has a molecular weight of 174.20 g/mol, XLogP of 0.51, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2,3-dimethoxypropanoic acid is sourced from PubChem (CID 116769537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).