C12H22O3 — CID 87103469
1-methoxy-2,2,6,6-tetramethylheptane-3,5-dione (PubChem CID 87103469) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 1-methoxy-2,2,6,6-tetramethylheptane-3,5-dione.
| Compound Name | 1-methoxy-2,2,6,6-tetramethylheptane-3,5-dione |
|---|---|
| PubChem CID | 87103469 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 1-methoxy-2,2,6,6-tetramethylheptane-3,5-dione |
| SMILES | COCC(C)(C)C(=O)CC(=O)C(C)(C)C |
| InChI | InChI=1S/C12H22O3/c1-11(2,3)9(13)7-10(14)12(4,5)8-15-6/h7-8H2,1-6H3 |
| InChIKey | QNLXXWOBNIYLGO-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|