C13H26O3Si — CID 22253512
2,2,6-trimethyl-6-trimethylsilyloxyheptane-3,5-dione (PubChem CID 22253512) has the molecular formula C13H26O3Si and a molecular weight of 258.43 g/mol. Its IUPAC name is 2,2,6-trimethyl-6-trimethylsilyloxyheptane-3,5-dione.
| Compound Name | 2,2,6-trimethyl-6-trimethylsilyloxyheptane-3,5-dione |
|---|---|
| PubChem CID | 22253512 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 2,2,6-trimethyl-6-trimethylsilyloxyheptane-3,5-dione |
| SMILES | CC(C)(C)C(=O)CC(=O)C(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-12(2,3)10(14)9-11(15)13(4,5)16-17(6,7)8/h9H2,1-8H3 |
| InChIKey | YPMLIGIXBJGLMQ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|