C15H32O4Si2 — CID 22253510
2,6-dimethyl-2,6-bis(trimethylsilyloxy)heptane-3,5-dione (PubChem CID 22253510) has the molecular formula C15H32O4Si2 and a molecular weight of 332.59 g/mol. Its IUPAC name is 2,6-dimethyl-2,6-bis(trimethylsilyloxy)heptane-3,5-dione.
| Compound Name | 2,6-dimethyl-2,6-bis(trimethylsilyloxy)heptane-3,5-dione |
|---|---|
| PubChem CID | 22253510 |
| Molecular Formula | C15H32O4Si2 |
| Molecular Weight | 332.59 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | 2,6-dimethyl-2,6-bis(trimethylsilyloxy)heptane-3,5-dione |
| SMILES | CC(C)(O[Si](C)(C)C)C(=O)CC(=O)C(C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H32O4Si2/c1-14(2,18-20(5,6)7)12(16)11-13(17)15(3,4)19-21(8,9)10/h11H2,1-10H3 |
| InChIKey | IXLCYTPRCFCSPI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.59 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|