About (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one
(Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one (PubChem CID 23594323) has the molecular formula C13H26O3Si
and a molecular weight of 258.43 g/mol. Its IUPAC name is (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one.
Molecular Properties
| Compound Name | (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one |
| PubChem CID | 23594323 |
| Molecular Formula | C13H26O3Si |
| Molecular Weight | 258.43 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one |
| SMILES | CC(C)(O[Si](C)(C)C)C(=O)/C=C(\O)C(C)(C)C |
| InChI | InChI=1S/C13H26O3Si/c1-12(2,3)10(14)9-11(15)13(4,5)16-17(6,7)8/h9,14H,1-8H3/b10-9- |
| InChIKey | AZJKYSPAJQBAPD-KTKRTIGZSA-N |
| XLogP | 3.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one?
The IUPAC name of (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one (CID 23594323) is (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one.
What is the SMILES notation for (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one?
The canonical SMILES for (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one is CC(C)(O[Si](C)(C)C)C(=O)/C=C(\O)C(C)(C)C.
What is the InChIKey of (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one?
The InChIKey is AZJKYSPAJQBAPD-KTKRTIGZSA-N. The full InChI is InChI=1S/C13H26O3Si/c1-12(2,3)10(14)9-11(15)13(4,5)16-17(6,7)8/h9,14H,1-8H3/b10-9-.
What are the key properties of (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one?
(Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one has a molecular weight of 258.43 g/mol, XLogP of 3.67, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-5-hydroxy-2,6,6-trimethyl-2-trimethylsilyloxyhept-4-en-3-one is sourced from PubChem (CID 23594323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).