About 1-methoxy-2,2,6-trimethylheptane-3,5-dione
1-methoxy-2,2,6-trimethylheptane-3,5-dione (PubChem CID 88959236) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 1-methoxy-2,2,6-trimethylheptane-3,5-dione.
Molecular Properties
| Compound Name | 1-methoxy-2,2,6-trimethylheptane-3,5-dione |
| PubChem CID | 88959236 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 1-methoxy-2,2,6-trimethylheptane-3,5-dione |
| SMILES | COCC(C)(C)C(=O)CC(=O)C(C)C |
| InChI | InChI=1S/C11H20O3/c1-8(2)9(12)6-10(13)11(3,4)7-14-5/h8H,6-7H2,1-5H3 |
| InChIKey | KZZSNFBZXMPXBF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2,2,6-trimethylheptane-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2,2,6-trimethylheptane-3,5-dione?
The IUPAC name of 1-methoxy-2,2,6-trimethylheptane-3,5-dione (CID 88959236) is 1-methoxy-2,2,6-trimethylheptane-3,5-dione.
What is the SMILES notation for 1-methoxy-2,2,6-trimethylheptane-3,5-dione?
The canonical SMILES for 1-methoxy-2,2,6-trimethylheptane-3,5-dione is COCC(C)(C)C(=O)CC(=O)C(C)C.
What is the InChIKey of 1-methoxy-2,2,6-trimethylheptane-3,5-dione?
The InChIKey is KZZSNFBZXMPXBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-8(2)9(12)6-10(13)11(3,4)7-14-5/h8H,6-7H2,1-5H3.
What are the key properties of 1-methoxy-2,2,6-trimethylheptane-3,5-dione?
1-methoxy-2,2,6-trimethylheptane-3,5-dione has a molecular weight of 200.28 g/mol, XLogP of 1.84, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2,2,6-trimethylheptane-3,5-dione is sourced from PubChem (CID 88959236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).