C11H20O2 — CID 87814005
2,6,6-trimethyloctane-3,5-dione (PubChem CID 87814005) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 2,6,6-trimethyloctane-3,5-dione.
| Compound Name | 2,6,6-trimethyloctane-3,5-dione |
|---|---|
| PubChem CID | 87814005 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 2,6,6-trimethyloctane-3,5-dione |
| SMILES | CCC(C)(C)C(=O)CC(=O)C(C)C |
| InChI | InChI=1S/C11H20O2/c1-6-11(4,5)10(13)7-9(12)8(2)3/h8H,6-7H2,1-5H3 |
| InChIKey | YRVOCRSIDLNTSJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|