C12H22O3 — CID 88959271
8-methoxy-2,6,6-trimethyloctane-3,5-dione (PubChem CID 88959271) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 8-methoxy-2,6,6-trimethyloctane-3,5-dione.
| Compound Name | 8-methoxy-2,6,6-trimethyloctane-3,5-dione |
|---|---|
| PubChem CID | 88959271 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 8-methoxy-2,6,6-trimethyloctane-3,5-dione |
| SMILES | COCCC(C)(C)C(=O)CC(=O)C(C)C |
| InChI | InChI=1S/C12H22O3/c1-9(2)10(13)8-11(14)12(3,4)6-7-15-5/h9H,6-8H2,1-5H3 |
| InChIKey | WKIAIVZBFKWBEP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|