C12H25NO3 — CID 115000588
4-methoxy-2-methyl-2-(4-methylpentan-2-ylamino)butanoic acid (PubChem CID 115000588) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-methoxy-2-methyl-2-(4-methylpentan-2-ylamino)butanoic acid.
| Compound Name | 4-methoxy-2-methyl-2-(4-methylpentan-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 115000588 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 4-methoxy-2-methyl-2-(4-methylpentan-2-ylamino)butanoic acid |
| SMILES | COCCC(C)(NC(C)CC(C)C)C(=O)O |
| InChI | InChI=1S/C12H25NO3/c1-9(2)8-10(3)13-12(4,11(14)15)6-7-16-5/h9-10,13H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | PVXKLAOAQWAIDI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |