C11H20F3NO2 — CID 116535586
2-(butan-2-ylamino)-6,6,6-trifluoro-2-methylhexanoic acid (PubChem CID 116535586) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-6,6,6-trifluoro-2-methylhexanoic acid.
| Compound Name | 2-(butan-2-ylamino)-6,6,6-trifluoro-2-methylhexanoic acid |
|---|---|
| PubChem CID | 116535586 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-(butan-2-ylamino)-6,6,6-trifluoro-2-methylhexanoic acid |
| SMILES | CCC(C)NC(C)(CCCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H20F3NO2/c1-4-8(2)15-10(3,9(16)17)6-5-7-11(12,13)14/h8,15H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | QFCPGUPBCDAJPB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |