C8H19Cl2NO2S — CID 174469242
2-(butan-2-ylamino)-2-methyl-3-sulfanylpropanoic acid;dihydrochloride (PubChem CID 174469242) has the molecular formula C8H19Cl2NO2S and a molecular weight of 264.22 g/mol. Its IUPAC name is 2-(butan-2-ylamino)-2-methyl-3-sulfanylpropanoic acid;dihydrochloride.
| Compound Name | 2-(butan-2-ylamino)-2-methyl-3-sulfanylpropanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 174469242 |
| Molecular Formula | C8H19Cl2NO2S |
| Molecular Weight | 264.22 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 2-(butan-2-ylamino)-2-methyl-3-sulfanylpropanoic acid;dihydrochloride |
| SMILES | CCC(C)NC(C)(CS)C(=O)O.Cl.Cl |
| InChI | InChI=1S/C8H17NO2S.2ClH/c1-4-6(2)9-8(3,5-12)7(10)11;;/h6,9,12H,4-5H2,1-3H3,(H,10,11);2*1H |
| InChIKey | NVMAUJQDRJRXBP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|