C10H19F3N2O — CID 116535472
6,6,6-trifluoro-2-methyl-2-(propan-2-ylamino)hexanamide (PubChem CID 116535472) has the molecular formula C10H19F3N2O and a molecular weight of 240.27 g/mol. Its IUPAC name is 6,6,6-trifluoro-2-methyl-2-(propan-2-ylamino)hexanamide.
| Compound Name | 6,6,6-trifluoro-2-methyl-2-(propan-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 116535472 |
| Molecular Formula | C10H19F3N2O |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 6,6,6-trifluoro-2-methyl-2-(propan-2-ylamino)hexanamide |
| SMILES | CC(C)NC(C)(CCCC(F)(F)F)C(N)=O |
| InChI | InChI=1S/C10H19F3N2O/c1-7(2)15-9(3,8(14)16)5-4-6-10(11,12)13/h7,15H,4-6H2,1-3H3,(H2,14,16) |
| InChIKey | FJBNGXDMIJCWJU-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |