C14H25F3N2O — CID 116535495
2-(cycloheptylamino)-6,6,6-trifluoro-2-methylhexanamide (PubChem CID 116535495) has the molecular formula C14H25F3N2O and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-(cycloheptylamino)-6,6,6-trifluoro-2-methylhexanamide.
| Compound Name | 2-(cycloheptylamino)-6,6,6-trifluoro-2-methylhexanamide |
|---|---|
| PubChem CID | 116535495 |
| Molecular Formula | C14H25F3N2O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-(cycloheptylamino)-6,6,6-trifluoro-2-methylhexanamide |
| SMILES | CC(CCCC(F)(F)F)(NC1CCCCCC1)C(N)=O |
| InChI | InChI=1S/C14H25F3N2O/c1-13(12(18)20,9-6-10-14(15,16)17)19-11-7-4-2-3-5-8-11/h11,19H,2-10H2,1H3,(H2,18,20) |
| InChIKey | NSIFTBCTBXRUEA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |