C11H24N2O2 — CID 60788184
4-methoxy-2,4-dimethyl-2-(propan-2-ylamino)pentanamide (PubChem CID 60788184) has the molecular formula C11H24N2O2 and a molecular weight of 216.32 g/mol. Its IUPAC name is 4-methoxy-2,4-dimethyl-2-(propan-2-ylamino)pentanamide.
| Compound Name | 4-methoxy-2,4-dimethyl-2-(propan-2-ylamino)pentanamide |
|---|---|
| PubChem CID | 60788184 |
| Molecular Formula | C11H24N2O2 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.18 |
| IUPAC Name | 4-methoxy-2,4-dimethyl-2-(propan-2-ylamino)pentanamide |
| SMILES | COC(C)(C)CC(C)(NC(C)C)C(N)=O |
| InChI | InChI=1S/C11H24N2O2/c1-8(2)13-11(5,9(12)14)7-10(3,4)15-6/h8,13H,7H2,1-6H3,(H2,12,14) |
| InChIKey | KDJGDLLCRMJIFN-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |