C12H25N3O2S — CID 114234454
2-methyl-3-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanyl-2-(propan-2-ylamino)propanamide (PubChem CID 114234454) has the molecular formula C12H25N3O2S and a molecular weight of 275.42 g/mol. Its IUPAC name is 2-methyl-3-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanyl-2-(propan-2-ylamino)propanamide.
| Compound Name | 2-methyl-3-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanyl-2-(propan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 114234454 |
| Molecular Formula | C12H25N3O2S |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 2-methyl-3-[2-oxo-2-(propan-2-ylamino)ethyl]sulfanyl-2-(propan-2-ylamino)propanamide |
| SMILES | CC(C)NC(=O)CSCC(C)(NC(C)C)C(N)=O |
| InChI | InChI=1S/C12H25N3O2S/c1-8(2)14-10(16)6-18-7-12(5,11(13)17)15-9(3)4/h8-9,15H,6-7H2,1-5H3,(H2,13,17)(H,14,16) |
| InChIKey | OVZHVHJSUVOHBD-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |