C6H13N3OS — CID 65212140
[2-oxo-2-(propan-2-ylamino)ethyl] carbamimidothioate (PubChem CID 65212140) has the molecular formula C6H13N3OS and a molecular weight of 175.26 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylamino)ethyl] carbamimidothioate.
| Compound Name | [2-oxo-2-(propan-2-ylamino)ethyl] carbamimidothioate |
|---|---|
| PubChem CID | 65212140 |
| Molecular Formula | C6H13N3OS |
| Molecular Weight | 175.26 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | [2-oxo-2-(propan-2-ylamino)ethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)NC(C)C |
| InChI | InChI=1S/C6H13N3OS/c1-4(2)9-5(10)3-11-6(7)8/h4H,3H2,1-2H3,(H3,7,8)(H,9,10) |
| InChIKey | SCJCUVBHMTYRBL-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.26 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|