C8H17N3OS — CID 60642003
[2-oxo-2-(pentan-2-ylamino)ethyl] carbamimidothioate (PubChem CID 60642003) has the molecular formula C8H17N3OS and a molecular weight of 203.31 g/mol. Its IUPAC name is [2-oxo-2-(pentan-2-ylamino)ethyl] carbamimidothioate.
| Compound Name | [2-oxo-2-(pentan-2-ylamino)ethyl] carbamimidothioate |
|---|---|
| PubChem CID | 60642003 |
| Molecular Formula | C8H17N3OS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | [2-oxo-2-(pentan-2-ylamino)ethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)NC(C)CCC |
| InChI | InChI=1S/C8H17N3OS/c1-3-4-6(2)11-7(12)5-13-8(9)10/h6H,3-5H2,1-2H3,(H3,9,10)(H,11,12) |
| InChIKey | ZGZXFZSXQJUQRI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|