C13H19N3OS — CID 40712388
[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] carbamimidothioate (PubChem CID 40712388) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] carbamimidothioate.
| Compound Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] carbamimidothioate |
|---|---|
| PubChem CID | 40712388 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)N[C@H](C)CCc1ccccc1 |
| InChI | InChI=1S/C13H19N3OS/c1-10(16-12(17)9-18-13(14)15)7-8-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H3,14,15)(H,16,17)/t10-/m1/s1 |
| InChIKey | GSGYBQPZCDWFJJ-SNVBAGLBSA-N |
| XLogP | 1.75 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|