C6H11N3OS — CID 65212148
[2-oxo-2-(prop-2-enylamino)ethyl] carbamimidothioate (PubChem CID 65212148) has the molecular formula C6H11N3OS and a molecular weight of 173.24 g/mol. Its IUPAC name is [2-oxo-2-(prop-2-enylamino)ethyl] carbamimidothioate.
| Compound Name | [2-oxo-2-(prop-2-enylamino)ethyl] carbamimidothioate |
|---|---|
| PubChem CID | 65212148 |
| Molecular Formula | C6H11N3OS |
| Molecular Weight | 173.24 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | [2-oxo-2-(prop-2-enylamino)ethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)NCC=C |
| InChI | InChI=1S/C6H11N3OS/c1-2-3-9-5(10)4-11-6(7)8/h2H,1,3-4H2,(H3,7,8)(H,9,10) |
| InChIKey | VPMUSQRJMPOMJZ-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.24 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|