C6H9N5O2S — CID 65211655
[2-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl] carbamimidothioate (PubChem CID 65211655) has the molecular formula C6H9N5O2S and a molecular weight of 215.24 g/mol. Its IUPAC name is [2-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl] carbamimidothioate.
| Compound Name | [2-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl] carbamimidothioate |
|---|---|
| PubChem CID | 65211655 |
| Molecular Formula | C6H9N5O2S |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | [2-[(5-methyl-1,3,4-oxadiazol-2-yl)amino]-2-oxoethyl] carbamimidothioate |
| SMILES | [H]/N=C(\N)SCC(=O)Nc1nnc(C)o1 |
| InChI | InChI=1S/C6H9N5O2S/c1-3-10-11-6(13-3)9-4(12)2-14-5(7)8/h2H2,1H3,(H3,7,8)(H,9,11,12) |
| InChIKey | IUAJMIYOSYGVGO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|