C11H11ClN4O2S — CID 43305123
2-(4-amino-2-chlorophenyl)sulfanyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide (PubChem CID 43305123) has the molecular formula C11H11ClN4O2S and a molecular weight of 298.76 g/mol. Its IUPAC name is 2-(4-amino-2-chlorophenyl)sulfanyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide.
| Compound Name | 2-(4-amino-2-chlorophenyl)sulfanyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 43305123 |
| Molecular Formula | C11H11ClN4O2S |
| Molecular Weight | 298.76 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-(4-amino-2-chlorophenyl)sulfanyl-N-(5-methyl-1,3,4-oxadiazol-2-yl)acetamide |
| SMILES | Cc1nnc(NC(=O)CSc2ccc(N)cc2Cl)o1 |
| InChI | InChI=1S/C11H11ClN4O2S/c1-6-15-16-11(18-6)14-10(17)5-19-9-3-2-7(13)4-8(9)12/h2-4H,5,13H2,1H3,(H,14,16,17) |
| InChIKey | ZHNBKTCWQCFXAW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.76 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|