C10H12ClN3O2S — CID 43305113
N'-acetyl-2-(4-amino-2-chlorophenyl)sulfanylacetohydrazide (PubChem CID 43305113) has the molecular formula C10H12ClN3O2S and a molecular weight of 273.75 g/mol. Its IUPAC name is N'-acetyl-2-(4-amino-2-chlorophenyl)sulfanylacetohydrazide.
| Compound Name | N'-acetyl-2-(4-amino-2-chlorophenyl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 43305113 |
| Molecular Formula | C10H12ClN3O2S |
| Molecular Weight | 273.75 g/mol |
| Exact Mass | 273.03 |
| IUPAC Name | N'-acetyl-2-(4-amino-2-chlorophenyl)sulfanylacetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1ccc(N)cc1Cl |
| InChI | InChI=1S/C10H12ClN3O2S/c1-6(15)13-14-10(16)5-17-9-3-2-7(12)4-8(9)11/h2-4H,5,12H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | UBRZJKBNJVMLKL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.75 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|