C10H10ClF3N2OS — CID 43305339
2-(4-amino-2-chlorophenyl)sulfanyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 43305339) has the molecular formula C10H10ClF3N2OS and a molecular weight of 298.72 g/mol. Its IUPAC name is 2-(4-amino-2-chlorophenyl)sulfanyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-(4-amino-2-chlorophenyl)sulfanyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 43305339 |
| Molecular Formula | C10H10ClF3N2OS |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-(4-amino-2-chlorophenyl)sulfanyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | Nc1ccc(SCC(=O)NCC(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C10H10ClF3N2OS/c11-7-3-6(15)1-2-8(7)18-4-9(17)16-5-10(12,13)14/h1-3H,4-5,15H2,(H,16,17) |
| InChIKey | DYSKQERDGHSYAU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|