C11H15N3O2S — CID 43302863
N'-acetyl-2-(4-amino-2-methylphenyl)sulfanylacetohydrazide (PubChem CID 43302863) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is N'-acetyl-2-(4-amino-2-methylphenyl)sulfanylacetohydrazide.
| Compound Name | N'-acetyl-2-(4-amino-2-methylphenyl)sulfanylacetohydrazide |
|---|---|
| PubChem CID | 43302863 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | N'-acetyl-2-(4-amino-2-methylphenyl)sulfanylacetohydrazide |
| SMILES | CC(=O)NNC(=O)CSc1ccc(N)cc1C |
| InChI | InChI=1S/C11H15N3O2S/c1-7-5-9(12)3-4-10(7)17-6-11(16)14-13-8(2)15/h3-5H,6,12H2,1-2H3,(H,13,15)(H,14,16) |
| InChIKey | MOTOQHBSODOWBP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|