C12H12Cl2N4O2S — CID 62255780
N-(4-amino-2,6-dichlorophenyl)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanamide (PubChem CID 62255780) has the molecular formula C12H12Cl2N4O2S and a molecular weight of 347.23 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanamide |
|---|---|
| PubChem CID | 62255780 |
| Molecular Formula | C12H12Cl2N4O2S |
| Molecular Weight | 347.23 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-3-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]propanamide |
| SMILES | Cc1nnc(SCCC(=O)Nc2c(Cl)cc(N)cc2Cl)o1 |
| InChI | InChI=1S/C12H12Cl2N4O2S/c1-6-17-18-12(20-6)21-3-2-10(19)16-11-8(13)4-7(15)5-9(11)14/h4-5H,2-3,15H2,1H3,(H,16,19) |
| InChIKey | JTPPALFFLKNZFG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.23 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|