C13H13Cl2N3O2S — CID 106921925
N-(4-amino-2,6-dichlorophenyl)-4-(1,3-oxazol-2-ylsulfanyl)butanamide (PubChem CID 106921925) has the molecular formula C13H13Cl2N3O2S and a molecular weight of 346.24 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-4-(1,3-oxazol-2-ylsulfanyl)butanamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-4-(1,3-oxazol-2-ylsulfanyl)butanamide |
|---|---|
| PubChem CID | 106921925 |
| Molecular Formula | C13H13Cl2N3O2S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-4-(1,3-oxazol-2-ylsulfanyl)butanamide |
| SMILES | Nc1cc(Cl)c(NC(=O)CCCSc2ncco2)c(Cl)c1 |
| InChI | InChI=1S/C13H13Cl2N3O2S/c14-9-6-8(16)7-10(15)12(9)18-11(19)2-1-5-21-13-17-3-4-20-13/h3-4,6-7H,1-2,5,16H2,(H,18,19) |
| InChIKey | HOWKQCNQPIDOHC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|