C12H14N2OS — CID 106924556
4-[3-(1,3-oxazol-2-ylsulfanyl)propyl]aniline (PubChem CID 106924556) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 4-[3-(1,3-oxazol-2-ylsulfanyl)propyl]aniline.
| Compound Name | 4-[3-(1,3-oxazol-2-ylsulfanyl)propyl]aniline |
|---|---|
| PubChem CID | 106924556 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 4-[3-(1,3-oxazol-2-ylsulfanyl)propyl]aniline |
| SMILES | Nc1ccc(CCCSc2ncco2)cc1 |
| InChI | InChI=1S/C12H14N2OS/c13-11-5-3-10(4-6-11)2-1-9-16-12-14-7-8-15-12/h3-8H,1-2,9,13H2 |
| InChIKey | BSWCQYCTAYATFV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|