C12H10Cl2N4OS — CID 63380982
N-(4-amino-2,6-dichlorophenyl)-2-pyrazin-2-ylsulfanylacetamide (PubChem CID 63380982) has the molecular formula C12H10Cl2N4OS and a molecular weight of 329.21 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-2-pyrazin-2-ylsulfanylacetamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-2-pyrazin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 63380982 |
| Molecular Formula | C12H10Cl2N4OS |
| Molecular Weight | 329.21 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-2-pyrazin-2-ylsulfanylacetamide |
| SMILES | Nc1cc(Cl)c(NC(=O)CSc2cnccn2)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl2N4OS/c13-8-3-7(15)4-9(14)12(8)18-10(19)6-20-11-5-16-1-2-17-11/h1-5H,6,15H2,(H,18,19) |
| InChIKey | BEENNTAHBVOBCQ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.21 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|