C14H14Cl2N2OS2 — CID 29033230
N-(4-amino-2,6-dichlorophenyl)-4-thiophen-2-ylsulfanylbutanamide (PubChem CID 29033230) has the molecular formula C14H14Cl2N2OS2 and a molecular weight of 361.32 g/mol. Its IUPAC name is N-(4-amino-2,6-dichlorophenyl)-4-thiophen-2-ylsulfanylbutanamide.
| Compound Name | N-(4-amino-2,6-dichlorophenyl)-4-thiophen-2-ylsulfanylbutanamide |
|---|---|
| PubChem CID | 29033230 |
| Molecular Formula | C14H14Cl2N2OS2 |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | N-(4-amino-2,6-dichlorophenyl)-4-thiophen-2-ylsulfanylbutanamide |
| SMILES | Nc1cc(Cl)c(NC(=O)CCCSc2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2OS2/c15-10-7-9(17)8-11(16)14(10)18-12(19)3-1-5-20-13-4-2-6-21-13/h2,4,6-8H,1,3,5,17H2,(H,18,19) |
| InChIKey | VNIGWRPCMHTXEJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|