C9H14N2OS2 — CID 63580812
5-thiophen-2-ylsulfanylpentanehydrazide (PubChem CID 63580812) has the molecular formula C9H14N2OS2 and a molecular weight of 230.36 g/mol. Its IUPAC name is 5-thiophen-2-ylsulfanylpentanehydrazide.
| Compound Name | 5-thiophen-2-ylsulfanylpentanehydrazide |
|---|---|
| PubChem CID | 63580812 |
| Molecular Formula | C9H14N2OS2 |
| Molecular Weight | 230.36 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 5-thiophen-2-ylsulfanylpentanehydrazide |
| SMILES | NNC(=O)CCCCSc1cccs1 |
| InChI | InChI=1S/C9H14N2OS2/c10-11-8(12)4-1-2-6-13-9-5-3-7-14-9/h3,5,7H,1-2,4,6,10H2,(H,11,12) |
| InChIKey | NZFNGLUKSSLBQB-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.36 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|