C9H13NOS2 — CID 58169495
N-(3-thiophen-2-ylsulfanylpropyl)acetamide (PubChem CID 58169495) has the molecular formula C9H13NOS2 and a molecular weight of 215.34 g/mol. Its IUPAC name is N-(3-thiophen-2-ylsulfanylpropyl)acetamide.
| Compound Name | N-(3-thiophen-2-ylsulfanylpropyl)acetamide |
|---|---|
| PubChem CID | 58169495 |
| Molecular Formula | C9H13NOS2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | N-(3-thiophen-2-ylsulfanylpropyl)acetamide |
| SMILES | CC(=O)NCCCSc1cccs1 |
| InChI | InChI=1S/C9H13NOS2/c1-8(11)10-5-3-7-13-9-4-2-6-12-9/h2,4,6H,3,5,7H2,1H3,(H,10,11) |
| InChIKey | OOKBMXOGHBUMDT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|