C18H24N2O2S2 — CID 173199914
6-acetamido-N,N-bis(thiophen-2-ylmethyl)hexanamide (PubChem CID 173199914) has the molecular formula C18H24N2O2S2 and a molecular weight of 364.54 g/mol. Its IUPAC name is 6-acetamido-N,N-bis(thiophen-2-ylmethyl)hexanamide.
| Compound Name | 6-acetamido-N,N-bis(thiophen-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 173199914 |
| Molecular Formula | C18H24N2O2S2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 6-acetamido-N,N-bis(thiophen-2-ylmethyl)hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)N(Cc1cccs1)Cc1cccs1 |
| InChI | InChI=1S/C18H24N2O2S2/c1-15(21)19-10-4-2-3-9-18(22)20(13-16-7-5-11-23-16)14-17-8-6-12-24-17/h5-8,11-12H,2-4,9-10,13-14H2,1H3,(H,19,21) |
| InChIKey | NJEQEBYLARGRLL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|