C12H19NO2S2 — CID 103919645
N-(6-hydroxyhexyl)-2-thiophen-2-ylsulfanylacetamide (PubChem CID 103919645) has the molecular formula C12H19NO2S2 and a molecular weight of 273.42 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-2-thiophen-2-ylsulfanylacetamide.
| Compound Name | N-(6-hydroxyhexyl)-2-thiophen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 103919645 |
| Molecular Formula | C12H19NO2S2 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | N-(6-hydroxyhexyl)-2-thiophen-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1cccs1)NCCCCCCO |
| InChI | InChI=1S/C12H19NO2S2/c14-8-4-2-1-3-7-13-11(15)10-17-12-6-5-9-16-12/h5-6,9,14H,1-4,7-8,10H2,(H,13,15) |
| InChIKey | KNIPZDBTMBOMBV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|