C18H17NO2S2 — CID 43066911
N-(2-naphthalen-2-yloxyethyl)-2-thiophen-2-ylsulfanylacetamide (PubChem CID 43066911) has the molecular formula C18H17NO2S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is N-(2-naphthalen-2-yloxyethyl)-2-thiophen-2-ylsulfanylacetamide.
| Compound Name | N-(2-naphthalen-2-yloxyethyl)-2-thiophen-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 43066911 |
| Molecular Formula | C18H17NO2S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-(2-naphthalen-2-yloxyethyl)-2-thiophen-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1cccs1)NCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H17NO2S2/c20-17(13-23-18-6-3-11-22-18)19-9-10-21-16-8-7-14-4-1-2-5-15(14)12-16/h1-8,11-12H,9-10,13H2,(H,19,20) |
| InChIKey | OXTGYHSAYVIMJQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|