C10H13NO4S2 — CID 103958096
methyl 2-hydroxy-3-[(2-thiophen-2-ylsulfanylacetyl)amino]propanoate (PubChem CID 103958096) has the molecular formula C10H13NO4S2 and a molecular weight of 275.35 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[(2-thiophen-2-ylsulfanylacetyl)amino]propanoate.
| Compound Name | methyl 2-hydroxy-3-[(2-thiophen-2-ylsulfanylacetyl)amino]propanoate |
|---|---|
| PubChem CID | 103958096 |
| Molecular Formula | C10H13NO4S2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | methyl 2-hydroxy-3-[(2-thiophen-2-ylsulfanylacetyl)amino]propanoate |
| SMILES | COC(=O)C(O)CNC(=O)CSc1cccs1 |
| InChI | InChI=1S/C10H13NO4S2/c1-15-10(14)7(12)5-11-8(13)6-17-9-3-2-4-16-9/h2-4,7,12H,5-6H2,1H3,(H,11,13) |
| InChIKey | CJYWWTBVRBSQNL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |