C14H12F3NOS2 — CID 38763023
2-thiophen-2-ylsulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide (PubChem CID 38763023) has the molecular formula C14H12F3NOS2 and a molecular weight of 331.38 g/mol. Its IUPAC name is 2-thiophen-2-ylsulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide.
| Compound Name | 2-thiophen-2-ylsulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 38763023 |
| Molecular Formula | C14H12F3NOS2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-thiophen-2-ylsulfanyl-N-[[4-(trifluoromethyl)phenyl]methyl]acetamide |
| SMILES | O=C(CSc1cccs1)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H12F3NOS2/c15-14(16,17)11-5-3-10(4-6-11)8-18-12(19)9-21-13-2-1-7-20-13/h1-7H,8-9H2,(H,18,19) |
| InChIKey | VYKCXBQDSYYIKO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |