C8H15N5OS — CID 83083193
[1-oxo-1-(prop-2-enylamino)propan-2-yl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 83083193) has the molecular formula C8H15N5OS and a molecular weight of 229.31 g/mol. Its IUPAC name is [1-oxo-1-(prop-2-enylamino)propan-2-yl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83083193 |
| Molecular Formula | C8H15N5OS |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | [1-oxo-1-(prop-2-enylamino)propan-2-yl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SC(C)C(=O)NCC=C |
| InChI | InChI=1S/C8H15N5OS/c1-3-4-12-6(14)5(2)15-8(11)13-7(9)10/h3,5H,1,4H2,2H3,(H,12,14)(H5,9,10,11,13) |
| InChIKey | AZTWTKASMAPYJZ-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 117.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|